![[ICO]](/icons/blank.gif) |
Name |
Last modified |
Size |
Description |
|
|---|
 |
Parent Directory |
|
- |
|
 |
2080 |
20-Apr-2018 16:20 |
- |
|
|
43zla |
20-Apr-2018 16:20 |
- |
|
|
47SOUL |
20-Apr-2018 16:20 |
- |
|
|
5angels |
20-Apr-2018 16:20 |
- |
|
|
A Blaze Colour |
20-Apr-2018 16:20 |
- |
|
|
Adilson Silva |
20-Apr-2018 16:20 |
- |
|
|
Affkt |
20-Apr-2018 16:20 |
- |
|
|
Aida |
20-Apr-2018 16:20 |
- |
|
|
Al Joseph |
20-Apr-2018 16:20 |
- |
|
|
Alesia |
20-Apr-2018 16:20 |
- |
|
|
Amore |
20-Apr-2018 16:20 |
- |
|
|
Anders |
20-Apr-2018 16:20 |
- |
|
|
Andrew Lloyd Webber; Royal Philharmonic Orchestra, Tony Britten |
20-Apr-2018 16:20 |
- |
|
|
Andy Wanted |
20-Apr-2018 16:20 |
- |
|
|
Annuals |
20-Apr-2018 16:20 |
- |
|
|
Antonsen & Golden |
20-Apr-2018 16:20 |
- |
|
|
Arkha Sva ⁄ Woods of Infinity |
20-Apr-2018 16:20 |
- |
|
|
Asm A Tik |
20-Apr-2018 16:20 |
- |
|
|
Astrakhan |
20-Apr-2018 16:20 |
- |
|
|
Astrograss |
20-Apr-2018 16:20 |
- |
|
|
Averzija |
20-Apr-2018 16:20 |
- |
|
|
Axel Zwingenberger & Lila Ammons |
20-Apr-2018 16:20 |
- |
|
|
Bartok; Rolf Reinhardt, Orchestre de Chambre Pro Musica, Stuttgart |
20-Apr-2018 16:20 |
- |
|
|
Basic Physics |
20-Apr-2018 16:20 |
- |
|
|
Battery Hens |
20-Apr-2018 16:20 |
- |
|
|
Bill Harley |
20-Apr-2018 16:20 |
- |
|
|
Birds Are Alive |
20-Apr-2018 16:20 |
- |
|
|
Blind Tigers |
20-Apr-2018 16:20 |
- |
|
|
Bloody Mary |
20-Apr-2018 16:20 |
- |
|
|
Bluetree |
20-Apr-2018 16:20 |
- |
|
|
Blunt Force Trauma |
20-Apr-2018 16:20 |
- |
|
|
Bob Welch |
20-Apr-2018 16:20 |
- |
|
|
Bohuslav Martinů; National Symphony Orchestra of Ukraine, Arthur Fagen |
20-Apr-2018 16:20 |
- |
|
|
Bond |
20-Apr-2018 16:20 |
- |
|
|
Bonnie Hayes and the Wild Combo |
20-Apr-2018 16:20 |
- |
|
|
Brad Bush |
20-Apr-2018 16:20 |
- |
|
|
Bradi Cerebri Ectomia |
20-Apr-2018 16:20 |
- |
|
|
Brahms, Schumann; János Starker, Rudolf Buchbinder |
20-Apr-2018 16:20 |
- |
|
|
Bruno Majcherek & Die Regento Stars |
20-Apr-2018 16:20 |
- |
|
|
Brutal Punishment |
20-Apr-2018 16:20 |
- |
|
|
CARRIE ANN |
20-Apr-2018 16:20 |
- |
|
|
CJ Burken |
20-Apr-2018 16:20 |
- |
|
|
Cactus's |
20-Apr-2018 16:20 |
- |
|
|
Camm Hunter |
20-Apr-2018 16:20 |
- |
|
|
Camp X-Ray |
20-Apr-2018 16:20 |
- |
|
|
Cara o Cruz |
20-Apr-2018 16:20 |
- |
|
|
Carl et les hommes-boîtes |
20-Apr-2018 16:20 |
- |
|
|
Cathode Ray Eyes |
20-Apr-2018 16:20 |
- |
|
|
Chainbreaker |
20-Apr-2018 16:20 |
- |
|
|
Changing Faces |
20-Apr-2018 16:20 |
- |
|
|
Chaos Cycle |
20-Apr-2018 16:20 |
- |
|
|
Chris Buck & The Big Horns |
20-Apr-2018 16:20 |
- |
|
|
Cold Resistance |
20-Apr-2018 16:20 |
- |
|
|
Coma In Algiers |
20-Apr-2018 16:20 |
- |
|
|
Copacabana Club |
20-Apr-2018 16:20 |
- |
|
|
Copland; Columbia Symphony Orchestra, New York Philharmonic, Leonard Bernstein, Aaron Copland |
20-Apr-2018 16:20 |
- |
|
|
Cramer Rouse |
20-Apr-2018 16:20 |
- |
|
|
Ctulu |
20-Apr-2018 16:20 |
- |
|
|
Cyril |
20-Apr-2018 16:20 |
- |
|
|
Côr Meibion Froncysyllte |
20-Apr-2018 16:20 |
- |
|
|
DJ Q feat. Louise Williams |
20-Apr-2018 16:20 |
- |
|
|
DLoaw & Co |
20-Apr-2018 16:20 |
- |
|
|
Dan Spătaru |
20-Apr-2018 16:20 |
- |
|
|
David Carreira feat. Dry |
20-Apr-2018 16:20 |
- |
|
|
David Desimpelaere & Erik Desimpelaere |
20-Apr-2018 16:20 |
- |
|
|
Dear Reader & Deutsches Filmorchester Babelsberg |
20-Apr-2018 16:20 |
- |
|
|
Dick |
20-Apr-2018 16:20 |
- |
|
|
Die Rhöner Säuwäntzt |
20-Apr-2018 16:20 |
- |
|
|
Dietrich Buxtehude; Helmut Walcha |
20-Apr-2018 16:20 |
- |
|
|
Distantly Viewed |
20-Apr-2018 16:20 |
- |
|
|
Draw the Emotional |
20-Apr-2018 16:20 |
- |
|
|
Duane Allman |
20-Apr-2018 16:20 |
- |
|
|
EEXEE |
20-Apr-2018 16:20 |
- |
|
|
Ebola |
20-Apr-2018 16:20 |
- |
|
|
Eduard Nápravník, Felix Blumenfeld; BBC Scottish Symphony Orchestra, Alexander Titov, Evgeny Soifertis |
20-Apr-2018 16:20 |
- |
|
|
Epiphany |
20-Apr-2018 16:20 |
- |
|
|
Eric Bell |
20-Apr-2018 16:20 |
- |
|
|
Escape from Emptiness |
20-Apr-2018 16:20 |
- |
|
|
Familie Sonntag |
20-Apr-2018 16:20 |
- |
|
|
Familien Akselsen |
20-Apr-2018 16:20 |
- |
|
|
Feedback |
20-Apr-2018 16:20 |
- |
|
|
Fei Comodo |
20-Apr-2018 16:20 |
- |
|
|
Felicity Lott, Graham Johnson |
20-Apr-2018 16:20 |
- |
|
|
Final Flash |
20-Apr-2018 16:20 |
- |
|
|
Fjaell |
20-Apr-2018 16:20 |
- |
|
|
Fletcher Henderson And His Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Forgotten Sunrise |
20-Apr-2018 16:20 |
- |
|
|
Fouled Out |
20-Apr-2018 16:20 |
- |
|
|
Franky Stein & The Creeps |
20-Apr-2018 16:20 |
- |
|
|
Frederick Delius, John Ireland; Ulster Orchestra, David Lloyd-Jones, Piers Lane |
20-Apr-2018 16:20 |
- |
|
|
FrostSeele |
20-Apr-2018 16:20 |
- |
|
|
Fuzz Manta |
20-Apr-2018 16:20 |
- |
|
|
Gabriel Fauré; Felicity Lott, Jennifer Smith, John Mark Ainsley, Jean-Paul Fouchécourt, Christopher Maltman, Stephen Varcoe, Graham Johnson, Ronan O'Hora |
20-Apr-2018 16:20 |
- |
|
|
Georg Eduard Goltermann |
20-Apr-2018 16:20 |
- |
|
|
Giovanni Gabrieli; The Taverner Choir, London Cornett & Sackbut Ensemble, Andrew Parrott |
20-Apr-2018 16:20 |
- |
|
|
God's Own Medicine |
20-Apr-2018 16:20 |
- |
|
|
Gonçalo Pereira |
20-Apr-2018 16:20 |
- |
|
|
Goran Karan |
20-Apr-2018 16:20 |
- |
|
|
Guchon |
20-Apr-2018 16:20 |
- |
|
|
Guz ⁄ Levy Shoemaker |
20-Apr-2018 16:20 |
- |
|
|
Hazylujah |
20-Apr-2018 16:20 |
- |
|
|
Headon |
20-Apr-2018 16:20 |
- |
|
|
Heidi Berry |
20-Apr-2018 16:20 |
- |
|
|
Holst, Vaughan Williams; André Previn, Sir Adrian Boult |
20-Apr-2018 16:20 |
- |
|
|
Hopscotch |
20-Apr-2018 16:20 |
- |
|
|
House of Atreus |
20-Apr-2018 16:20 |
- |
|
|
Hulk |
20-Apr-2018 16:20 |
- |
|
|
I.B.M. |
20-Apr-2018 16:20 |
- |
|
|
Impel |
20-Apr-2018 16:20 |
- |
|
|
Impurity |
20-Apr-2018 16:20 |
- |
|
|
Iunema |
20-Apr-2018 16:20 |
- |
|
|
Jacob Phono & Jens Bond |
20-Apr-2018 16:20 |
- |
|
|
Jake Sims |
20-Apr-2018 16:20 |
- |
|
|
Jody Breeze & DJ Ideal |
20-Apr-2018 16:20 |
- |
|
|
Joe Jack Wagner |
20-Apr-2018 16:20 |
- |
|
|
Johann Sebastian Bach; Ara Malikian |
20-Apr-2018 16:20 |
- |
|
|
Johnny Law & The Pistol Packin' Daddies |
20-Apr-2018 16:20 |
- |
|
|
Jouni Keronen & Anette Ekholm |
20-Apr-2018 16:20 |
- |
|
|
Jukka Salminen |
20-Apr-2018 16:20 |
- |
|
|
Junior Mance + Joe Temperley |
20-Apr-2018 16:20 |
- |
|
|
Kabanos |
20-Apr-2018 16:20 |
- |
|
|
Kari Kriikku, Avanti Chamber Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Karnon |
20-Apr-2018 16:20 |
- |
|
|
Keith Ganz |
20-Apr-2018 16:20 |
- |
|
|
Ken Peplowski Quintet |
20-Apr-2018 16:20 |
- |
|
|
Killer Command |
20-Apr-2018 16:20 |
- |
|
|
Klima Kalima |
20-Apr-2018 16:20 |
- |
|
|
Knockout Greg & Blue Weather |
20-Apr-2018 16:20 |
- |
|
|
Koyxen |
20-Apr-2018 16:20 |
- |
|
|
Lantlôs |
20-Apr-2018 16:20 |
- |
|
|
Leopold Hofmann; Northern Sinfonia, Timothy Hugh |
20-Apr-2018 16:20 |
- |
|
|
Lion Twin |
20-Apr-2018 16:20 |
- |
|
|
Ljoba Jenče |
20-Apr-2018 16:20 |
- |
|
|
Loredana Berté |
20-Apr-2018 16:20 |
- |
|
|
Lowness |
20-Apr-2018 16:20 |
- |
|
|
Lunarsea |
20-Apr-2018 16:20 |
- |
|
|
Malanoctem |
20-Apr-2018 16:20 |
- |
|
|
Manda Rin |
20-Apr-2018 16:20 |
- |
|
|
Mara |
20-Apr-2018 16:20 |
- |
|
|
Marawa |
20-Apr-2018 16:20 |
- |
|
|
Marcus Viana |
20-Apr-2018 16:20 |
- |
|
|
Marijosé Alie |
20-Apr-2018 16:20 |
- |
|
|
Mario Guacarán |
20-Apr-2018 16:20 |
- |
|
|
Mark O'Leary, Ståle Storløkken, Stein Inge Braekhus |
20-Apr-2018 16:20 |
- |
|
|
Mat Zo feat. Chuck D |
20-Apr-2018 16:20 |
- |
|
|
Matt Watson |
20-Apr-2018 16:20 |
- |
|
|
Matty Woods |
20-Apr-2018 16:20 |
- |
|
|
Megora |
20-Apr-2018 16:20 |
- |
|
|
Mesemon Ecrof |
20-Apr-2018 16:20 |
- |
|
|
Middleworld |
20-Apr-2018 16:20 |
- |
|
|
Moonreich |
20-Apr-2018 16:20 |
- |
|
|
Mozart; Columbia Symphony Orchestra, Leonard Bernstein |
20-Apr-2018 16:20 |
- |
|
|
Mozart; David Shifrin, Mostly Mozart Orchestra, Gerard Schwarz, Chamber Music Northwest |
20-Apr-2018 16:20 |
- |
|
|
Mozart; Rundfunkchor Leipzig, Staatskapelle Dresden, Karl Böhm |
20-Apr-2018 16:20 |
- |
|
|
Mythe 2 |
20-Apr-2018 16:20 |
- |
|
|
Neumann, Kaija Kärkinen ja Ile Kallio, Tommi Soidinmäki, Jenna, Pave Maijanen, Eija Kantola, Panu Larnos, Remu |
20-Apr-2018 16:20 |
- |
|
|
Nomoto Karia |
20-Apr-2018 16:20 |
- |
|
|
Orga vs Red 1 |
20-Apr-2018 16:20 |
- |
|
|
Ossi Ahlapuro |
20-Apr-2018 16:20 |
- |
|
|
Overtone |
20-Apr-2018 16:20 |
- |
|
|
Pacific Mambo Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Paranom & Purpose |
20-Apr-2018 16:20 |
- |
|
|
Parween Sultana |
20-Apr-2018 16:20 |
- |
|
|
Paul Piché |
20-Apr-2018 16:20 |
- |
|
|
Paxy Cadena |
20-Apr-2018 16:20 |
- |
|
|
Pete Morton |
20-Apr-2018 16:20 |
- |
|
|
Pharoah |
20-Apr-2018 16:20 |
- |
|
|
Printer Clips |
20-Apr-2018 16:20 |
- |
|
|
P∴Rhythmatiq |
20-Apr-2018 16:20 |
- |
|
|
Qibe |
20-Apr-2018 16:20 |
- |
|
|
Quango & Sparky |
20-Apr-2018 16:20 |
- |
|
|
R. Strauss; Barry Tuckwell, Royal Philharmonic Orchestra, Vladimir Ashkenazy |
20-Apr-2018 16:20 |
- |
|
|
RLW & SRMeixner |
20-Apr-2018 16:20 |
- |
|
|
Rainer Trueby |
20-Apr-2018 16:20 |
- |
|
|
Ramona Córdova |
20-Apr-2018 16:20 |
- |
|
|
Rayhan Kadar |
20-Apr-2018 16:20 |
- |
|
|
Rdeči baron |
20-Apr-2018 16:20 |
- |
|
|
Rebecca Black & Dave Days |
20-Apr-2018 16:20 |
- |
|
|
Red Hot Banjos |
20-Apr-2018 16:20 |
- |
|
|
Remedy Krewe |
20-Apr-2018 16:20 |
- |
|
|
Richard Strauss; Royal Philharmonic Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Rihanna feat. Sean Paul |
20-Apr-2018 16:20 |
- |
|
|
Rudy Vallee & Al Bowley |
20-Apr-2018 16:20 |
- |
|
|
Sabina |
20-Apr-2018 16:20 |
- |
|
|
Sacrificed Alliance |
20-Apr-2018 16:20 |
- |
|
|
Saiko |
20-Apr-2018 16:20 |
- |
|
|
Santana feat. Juanes |
20-Apr-2018 16:20 |
- |
|
|
Satinath Mukherjee |
20-Apr-2018 16:20 |
- |
|
|
Schubert; Alban Berg Quartett |
20-Apr-2018 16:20 |
- |
|
|
Schubert; Alban Berg Quartett, Elisabeth Leonskaja, Georg Hörtnagel |
20-Apr-2018 16:20 |
- |
|
|
Schwester S feat. Rödelheim Hartreim Projekt |
20-Apr-2018 16:20 |
- |
|
|
Seker |
20-Apr-2018 16:20 |
- |
|
|
Shinkasta |
20-Apr-2018 16:20 |
- |
|
|
Simply Undrea |
20-Apr-2018 16:20 |
- |
|
|
Sir Thomas Beecham |
20-Apr-2018 16:20 |
- |
|
|
Soulstack |
20-Apr-2018 16:20 |
- |
|
|
Space Siren |
20-Apr-2018 16:20 |
- |
|
|
Spēka dziesmas |
20-Apr-2018 16:20 |
- |
|
|
Stash Wyslouch |
20-Apr-2018 16:20 |
- |
|
|
Stay Ali |
20-Apr-2018 16:20 |
- |
|
|
Steel Inferno |
20-Apr-2018 16:20 |
- |
|
|
Steel Messiah |
20-Apr-2018 16:20 |
- |
|
|
Still Square |
20-Apr-2018 16:20 |
- |
|
|
Strauss, Schumann; Mstislav Rostropovich, Herbert von Karajan, Leonard Bernstein |
20-Apr-2018 16:20 |
- |
|
|
Swim Ignorant Fire ⁄ Boar |
20-Apr-2018 16:20 |
- |
|
|
Synk;yet |
20-Apr-2018 16:20 |
- |
|
|
Tangent Plane |
20-Apr-2018 16:20 |
- |
|
|
Tanja Lainio |
20-Apr-2018 16:20 |
- |
|
|
The Angel Tree Children's Choir |
20-Apr-2018 16:20 |
- |
|
|
The Break In |
20-Apr-2018 16:20 |
- |
|
|
The Burial |
20-Apr-2018 16:20 |
- |
|
|
The Cataracs |
20-Apr-2018 16:20 |
- |
|
|
The Crystal Method feat. Matisyahu |
20-Apr-2018 16:20 |
- |
|
|
The Escorts |
20-Apr-2018 16:20 |
- |
|
|
The Farmhouse Killings |
20-Apr-2018 16:20 |
- |
|
|
The Happy Bullets |
20-Apr-2018 16:20 |
- |
|
|
The Intelligence ⁄ Popular Shapes |
20-Apr-2018 16:20 |
- |
|
|
The Lucky Daltons |
20-Apr-2018 16:20 |
- |
|
|
The Romford Stompers ⁄ Mary & Ken |
20-Apr-2018 16:20 |
- |
|
|
The Wolves of Avalon ⁄ The Meads of Asphodel |
20-Apr-2018 16:20 |
- |
|
|
The Wonderminers |
20-Apr-2018 16:20 |
- |
|
|
Tiga vs. Audion |
20-Apr-2018 16:20 |
- |
|
|
Tiiti |
20-Apr-2018 16:20 |
- |
|
|
Tillmann |
20-Apr-2018 16:20 |
- |
|
|
Tim O’Brien & Darrell Scott |
20-Apr-2018 16:20 |
- |
|
|
Time |
20-Apr-2018 16:20 |
- |
|
|
Todd Bryanton, Joel Douek and Christopher Young |
20-Apr-2018 16:20 |
- |
|
|
Trepanation |
20-Apr-2018 16:20 |
- |
|
|
Typhoon & New Cool Collective |
20-Apr-2018 16:20 |
- |
|
|
Urban Koder |
20-Apr-2018 16:20 |
- |
|
|
V Formation |
20-Apr-2018 16:20 |
- |
|
|
Valise |
20-Apr-2018 16:20 |
- |
|
|
Vaughan Williams; London Philharmonic Orchestra & Choir, Sir Adrian Boult, John Cameron, Isobel Baillie |
20-Apr-2018 16:20 |
- |
|
|
Vhöl |
20-Apr-2018 16:20 |
- |
|
|
Victoria Aveyard gelesen von Britta Steffenhagen |
20-Apr-2018 16:20 |
- |
|
|
Vlada i Gile |
20-Apr-2018 16:20 |
- |
|
|
White Noise Mashups |
20-Apr-2018 16:20 |
- |
|
|
Wikkid |
20-Apr-2018 16:20 |
- |
|
|
Wilson |
20-Apr-2018 16:20 |
- |
|
|
Wuzet |
20-Apr-2018 16:20 |
- |
|
|
Xalynar |
20-Apr-2018 16:20 |
- |
|
|
Yodelin' Slim Clark |
20-Apr-2018 16:20 |
- |
|
|
Zoran Predin & ArtBiro Quintett |
20-Apr-2018 16:20 |
- |
|
|
Zunzagi |
20-Apr-2018 16:20 |
- |
|
|
Zymoticz |
20-Apr-2018 16:20 |
- |
|
|
[dunkelbunt] feat. Selecta Bence |
20-Apr-2018 16:20 |
- |
|
|
the Last to Sleep |
20-Apr-2018 16:20 |
- |
|
|
Χάρις Αλεξίου & Κώστας Χατζής |
20-Apr-2018 16:20 |
- |
|
|
Стальные Нервы |
20-Apr-2018 16:20 |
- |
|
|
木村雅彦, 古川もとあき & 江川麻理子 |
20-Apr-2018 16:20 |
- |
|
|
|---|